C25H27N3O6 — CID 16520781
[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(phenoxymethyl)benzoate (PubChem CID 16520781) has the molecular formula C25H27N3O6 and a molecular weight of 465.51 g/mol. Its IUPAC name is [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(phenoxymethyl)benzoate.
| Compound Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(phenoxymethyl)benzoate |
|---|---|
| PubChem CID | 16520781 |
| Molecular Formula | C25H27N3O6 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-(phenoxymethyl)benzoate |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)COC(=O)c1ccccc1COc1ccccc1)C2=O |
| InChI | InChI=1S/C25H27N3O6/c1-17-11-13-25(14-12-17)23(31)28(24(32)26-25)27-21(29)16-34-22(30)20-10-6-5-7-18(20)15-33-19-8-3-2-4-9-19/h2-10,17H,11-16H2,1H3,(H,26,32)(H,27,29) |
| InChIKey | PHSAGYFQMSYRMZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|