C26H34N4O5 — CID 16505168
[2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-[2-(cyclohexen-1-yl)ethylamino]benzoate (PubChem CID 16505168) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-[2-(cyclohexen-1-yl)ethylamino]benzoate.
| Compound Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-[2-(cyclohexen-1-yl)ethylamino]benzoate |
|---|---|
| PubChem CID | 16505168 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | [2-[(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)amino]-2-oxoethyl] 2-[2-(cyclohexen-1-yl)ethylamino]benzoate |
| SMILES | CC1CCC2(CC1)NC(=O)N(NC(=O)COC(=O)c1ccccc1NCCC1=CCCCC1)C2=O |
| InChI | InChI=1S/C26H34N4O5/c1-18-11-14-26(15-12-18)24(33)30(25(34)28-26)29-22(31)17-35-23(32)20-9-5-6-10-21(20)27-16-13-19-7-3-2-4-8-19/h5-7,9-10,18,27H,2-4,8,11-17H2,1H3,(H,28,34)(H,29,31) |
| InChIKey | CXYYAQCSQQJXLH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|