C20H28N2O3 — CID 109014793
ethyl 2-[[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropyl]amino]benzoate (PubChem CID 109014793) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is ethyl 2-[[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropyl]amino]benzoate.
| Compound Name | ethyl 2-[[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropyl]amino]benzoate |
|---|---|
| PubChem CID | 109014793 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | ethyl 2-[[3-[2-(cyclohexen-1-yl)ethylamino]-3-oxopropyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NCCC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C20H28N2O3/c1-2-25-20(24)17-10-6-7-11-18(17)21-15-13-19(23)22-14-12-16-8-4-3-5-9-16/h6-8,10-11,21H,2-5,9,12-15H2,1H3,(H,22,23) |
| InChIKey | FUGYQRRMDNOGQG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|