About ethyl 2-(propylamino)benzoate
ethyl 2-(propylamino)benzoate (PubChem CID 15662762) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is ethyl 2-(propylamino)benzoate.
Molecular Properties
| Compound Name | ethyl 2-(propylamino)benzoate |
| PubChem CID | 15662762 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | ethyl 2-(propylamino)benzoate |
| SMILES | CCCNc1ccccc1C(=O)OCC |
| InChI | InChI=1S/C12H17NO2/c1-3-9-13-11-8-6-5-7-10(11)12(14)15-4-2/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | HHTBHGDTHQBCFN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(propylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(propylamino)benzoate?
The IUPAC name of ethyl 2-(propylamino)benzoate (CID 15662762) is ethyl 2-(propylamino)benzoate.
What is the SMILES notation for ethyl 2-(propylamino)benzoate?
The canonical SMILES for ethyl 2-(propylamino)benzoate is CCCNc1ccccc1C(=O)OCC.
What is the InChIKey of ethyl 2-(propylamino)benzoate?
The InChIKey is HHTBHGDTHQBCFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-3-9-13-11-8-6-5-7-10(11)12(14)15-4-2/h5-8,13H,3-4,9H2,1-2H3.
What are the key properties of ethyl 2-(propylamino)benzoate?
ethyl 2-(propylamino)benzoate has a molecular weight of 207.27 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(propylamino)benzoate is sourced from PubChem (CID 15662762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).