C22H30N2O4 — CID 113116860
ethyl 2-[3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]propanoylamino]benzoate (PubChem CID 113116860) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is ethyl 2-[3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]propanoylamino]benzoate.
| Compound Name | ethyl 2-[3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 113116860 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | ethyl 2-[3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CCN(CCC1=CCCCC1)C(C)=O |
| InChI | InChI=1S/C22H30N2O4/c1-3-28-22(27)19-11-7-8-12-20(19)23-21(26)14-16-24(17(2)25)15-13-18-9-5-4-6-10-18/h7-9,11-12H,3-6,10,13-16H2,1-2H3,(H,23,26) |
| InChIKey | LDWYVRXGBZFVQQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|