C20H27ClN2O2 — CID 113116811
3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-(3-chloro-4-methylphenyl)propanamide (PubChem CID 113116811) has the molecular formula C20H27ClN2O2 and a molecular weight of 362.90 g/mol. Its IUPAC name is 3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-(3-chloro-4-methylphenyl)propanamide.
| Compound Name | 3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-(3-chloro-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 113116811 |
| Molecular Formula | C20H27ClN2O2 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-(3-chloro-4-methylphenyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1ccc(C)c(Cl)c1)CCC1=CCCCC1 |
| InChI | InChI=1S/C20H27ClN2O2/c1-15-8-9-18(14-19(15)21)22-20(25)11-13-23(16(2)24)12-10-17-6-4-3-5-7-17/h6,8-9,14H,3-5,7,10-13H2,1-2H3,(H,22,25) |
| InChIKey | OVIPJZBZNOLUTA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|