C19H24Cl2N2O2 — CID 113116857
3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-(2,3-dichlorophenyl)propanamide (PubChem CID 113116857) has the molecular formula C19H24Cl2N2O2 and a molecular weight of 383.32 g/mol. Its IUPAC name is 3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-(2,3-dichlorophenyl)propanamide.
| Compound Name | 3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-(2,3-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 113116857 |
| Molecular Formula | C19H24Cl2N2O2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-[acetyl-[2-(cyclohexen-1-yl)ethyl]amino]-N-(2,3-dichlorophenyl)propanamide |
| SMILES | CC(=O)N(CCC(=O)Nc1cccc(Cl)c1Cl)CCC1=CCCCC1 |
| InChI | InChI=1S/C19H24Cl2N2O2/c1-14(24)23(12-10-15-6-3-2-4-7-15)13-11-18(25)22-17-9-5-8-16(20)19(17)21/h5-6,8-9H,2-4,7,10-13H2,1H3,(H,22,25) |
| InChIKey | GUNDLWAQMIJHBJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|