C17H23ClN2O — CID 54815757
N-(3-chloro-2-methylphenyl)-2-[2-(cyclohexen-1-yl)ethylamino]acetamide (PubChem CID 54815757) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[2-(cyclohexen-1-yl)ethylamino]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[2-(cyclohexen-1-yl)ethylamino]acetamide |
|---|---|
| PubChem CID | 54815757 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[2-(cyclohexen-1-yl)ethylamino]acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CNCCC1=CCCCC1 |
| InChI | InChI=1S/C17H23ClN2O/c1-13-15(18)8-5-9-16(13)20-17(21)12-19-11-10-14-6-3-2-4-7-14/h5-6,8-9,19H,2-4,7,10-12H2,1H3,(H,20,21) |
| InChIKey | HMJCWUAIPIGENW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|