C19H25ClN2O3 — CID 3372986
4-(3-chloro-2-methylanilino)-2-[2-(cyclohexen-1-yl)ethylamino]-4-oxobutanoic acid (PubChem CID 3372986) has the molecular formula C19H25ClN2O3 and a molecular weight of 364.87 g/mol. Its IUPAC name is 4-(3-chloro-2-methylanilino)-2-[2-(cyclohexen-1-yl)ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-(3-chloro-2-methylanilino)-2-[2-(cyclohexen-1-yl)ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3372986 |
| Molecular Formula | C19H25ClN2O3 |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 4-(3-chloro-2-methylanilino)-2-[2-(cyclohexen-1-yl)ethylamino]-4-oxobutanoic acid |
| SMILES | Cc1c(Cl)cccc1NC(=O)CC(NCCC1=CCCCC1)C(=O)O |
| InChI | InChI=1S/C19H25ClN2O3/c1-13-15(20)8-5-9-16(13)22-18(23)12-17(19(24)25)21-11-10-14-6-3-2-4-7-14/h5-6,8-9,17,21H,2-4,7,10-12H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | YUIBTTUNIFTVTD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|