C18H23N3O5 — CID 18858434
2-[2-(cyclohexen-1-yl)ethylamino]-4-(2-nitroanilino)-4-oxobutanoic acid (PubChem CID 18858434) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-4-(2-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-4-(2-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18858434 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-4-(2-nitroanilino)-4-oxobutanoic acid |
| SMILES | O=C(CC(NCCC1=CCCCC1)C(=O)O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H23N3O5/c22-17(20-14-8-4-5-9-16(14)21(25)26)12-15(18(23)24)19-11-10-13-6-2-1-3-7-13/h4-6,8-9,15,19H,1-3,7,10-12H2,(H,20,22)(H,23,24) |
| InChIKey | QRTIPGOQFCCJDN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|