C17H24ClN3O4 — CID 3236231
4-(3-chloro-2-methylanilino)-2-(2-morpholin-4-ylethylamino)-4-oxobutanoic acid (PubChem CID 3236231) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is 4-(3-chloro-2-methylanilino)-2-(2-morpholin-4-ylethylamino)-4-oxobutanoic acid.
| Compound Name | 4-(3-chloro-2-methylanilino)-2-(2-morpholin-4-ylethylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 3236231 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-(3-chloro-2-methylanilino)-2-(2-morpholin-4-ylethylamino)-4-oxobutanoic acid |
| SMILES | Cc1c(Cl)cccc1NC(=O)CC(NCCN1CCOCC1)C(=O)O |
| InChI | InChI=1S/C17H24ClN3O4/c1-12-13(18)3-2-4-14(12)20-16(22)11-15(17(23)24)19-5-6-21-7-9-25-10-8-21/h2-4,15,19H,5-11H2,1H3,(H,20,22)(H,23,24) |
| InChIKey | CKRKOPFJXCNUHS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |