C17H23Cl2N3O4 — CID 4860933
4-(2,5-dichloroanilino)-2-(3-morpholin-4-ylpropylamino)-4-oxobutanoic acid (PubChem CID 4860933) has the molecular formula C17H23Cl2N3O4 and a molecular weight of 404.29 g/mol. Its IUPAC name is 4-(2,5-dichloroanilino)-2-(3-morpholin-4-ylpropylamino)-4-oxobutanoic acid.
| Compound Name | 4-(2,5-dichloroanilino)-2-(3-morpholin-4-ylpropylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 4860933 |
| Molecular Formula | C17H23Cl2N3O4 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 4-(2,5-dichloroanilino)-2-(3-morpholin-4-ylpropylamino)-4-oxobutanoic acid |
| SMILES | O=C(CC(NCCCN1CCOCC1)C(=O)O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H23Cl2N3O4/c18-12-2-3-13(19)14(10-12)21-16(23)11-15(17(24)25)20-4-1-5-22-6-8-26-9-7-22/h2-3,10,15,20H,1,4-9,11H2,(H,21,23)(H,24,25) |
| InChIKey | KLHYOWPKPVDWBB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|