C18H18Cl2N2O3 — CID 40567011
(2R)-4-(2,3-dichloroanilino)-4-oxo-2-(2-phenylethylamino)butanoic acid (PubChem CID 40567011) has the molecular formula C18H18Cl2N2O3 and a molecular weight of 381.26 g/mol. Its IUPAC name is (2R)-4-(2,3-dichloroanilino)-4-oxo-2-(2-phenylethylamino)butanoic acid.
| Compound Name | (2R)-4-(2,3-dichloroanilino)-4-oxo-2-(2-phenylethylamino)butanoic acid |
|---|---|
| PubChem CID | 40567011 |
| Molecular Formula | C18H18Cl2N2O3 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | (2R)-4-(2,3-dichloroanilino)-4-oxo-2-(2-phenylethylamino)butanoic acid |
| SMILES | O=C(C[C@@H](NCCc1ccccc1)C(=O)O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H18Cl2N2O3/c19-13-7-4-8-14(17(13)20)22-16(23)11-15(18(24)25)21-10-9-12-5-2-1-3-6-12/h1-8,15,21H,9-11H2,(H,22,23)(H,24,25)/t15-/m1/s1 |
| InChIKey | GFULNRADMVOYRC-OAHLLOKOSA-N |
| XLogP | 3.61 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |