C14H17Cl2N3O7 — CID 16807005
2-(2-aminoethylamino)-4-(2,3-dichloroanilino)-4-oxobutanoic acid;oxalic acid (PubChem CID 16807005) has the molecular formula C14H17Cl2N3O7 and a molecular weight of 410.21 g/mol. Its IUPAC name is 2-(2-aminoethylamino)-4-(2,3-dichloroanilino)-4-oxobutanoic acid;oxalic acid.
| Compound Name | 2-(2-aminoethylamino)-4-(2,3-dichloroanilino)-4-oxobutanoic acid;oxalic acid |
|---|---|
| PubChem CID | 16807005 |
| Molecular Formula | C14H17Cl2N3O7 |
| Molecular Weight | 410.21 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 2-(2-aminoethylamino)-4-(2,3-dichloroanilino)-4-oxobutanoic acid;oxalic acid |
| SMILES | NCCNC(CC(=O)Nc1cccc(Cl)c1Cl)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H15Cl2N3O3.C2H2O4/c13-7-2-1-3-8(11(7)14)17-10(18)6-9(12(19)20)16-5-4-15;3-1(4)2(5)6/h1-3,9,16H,4-6,15H2,(H,17,18)(H,19,20);(H,3,4)(H,5,6) |
| InChIKey | YEBWYJAUPZJAGV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|