C27H30ClN3O2S — CID 3280254
N-(3-chloro-2-methylphenyl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 3280254) has the molecular formula C27H30ClN3O2S and a molecular weight of 496.08 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 3280254 |
| Molecular Formula | C27H30ClN3O2S |
| Molecular Weight | 496.08 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[3-[2-(cyclohexen-1-yl)ethyl]-2-(4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(/N=C2\SC(CC(=O)Nc3cccc(Cl)c3C)C(=O)N2CCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C27H30ClN3O2S/c1-18-11-13-21(14-12-18)29-27-31(16-15-20-7-4-3-5-8-20)26(33)24(34-27)17-25(32)30-23-10-6-9-22(28)19(23)2/h6-7,9-14,24H,3-5,8,15-17H2,1-2H3,(H,30,32)/b29-27- |
| InChIKey | BHEFDWTZSWYVHC-OHYPFYFLSA-N |
| XLogP | 6.81 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.08 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|