C25H24Cl2FN3O2S — CID 2401699
2-[(5S)-3-[2-(cyclohexen-1-yl)ethyl]-2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 2401699) has the molecular formula C25H24Cl2FN3O2S and a molecular weight of 520.46 g/mol. Its IUPAC name is 2-[(5S)-3-[2-(cyclohexen-1-yl)ethyl]-2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5S)-3-[2-(cyclohexen-1-yl)ethyl]-2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 2401699 |
| Molecular Formula | C25H24Cl2FN3O2S |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 2-[(5S)-3-[2-(cyclohexen-1-yl)ethyl]-2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(C[C@@H]1S/C(=N\c2ccc(Cl)c(Cl)c2)N(CCC2=CCCCC2)C1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C25H24Cl2FN3O2S/c26-20-11-10-19(14-21(20)27)30-25-31(13-12-16-4-2-1-3-5-16)24(33)22(34-25)15-23(32)29-18-8-6-17(28)7-9-18/h4,6-11,14,22H,1-3,5,12-13,15H2,(H,29,32)/b30-25-/t22-/m0/s1 |
| InChIKey | WNUIUDBDERIBQC-XNTIDICGSA-N |
| XLogP | 6.98 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|