C26H26ClF2N3O2S — CID 2441812
2-[(5R)-2-(3-chloro-4-methylphenyl)imino-3-[2-(cyclohexen-1-yl)ethyl]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 2441812) has the molecular formula C26H26ClF2N3O2S and a molecular weight of 518.03 g/mol. Its IUPAC name is 2-[(5R)-2-(3-chloro-4-methylphenyl)imino-3-[2-(cyclohexen-1-yl)ethyl]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[(5R)-2-(3-chloro-4-methylphenyl)imino-3-[2-(cyclohexen-1-yl)ethyl]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 2441812 |
| Molecular Formula | C26H26ClF2N3O2S |
| Molecular Weight | 518.03 g/mol |
| Exact Mass | 517.14 |
| IUPAC Name | 2-[(5R)-2-(3-chloro-4-methylphenyl)imino-3-[2-(cyclohexen-1-yl)ethyl]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | Cc1ccc(/N=C2\S[C@H](CC(=O)Nc3ccc(F)cc3F)C(=O)N2CCC2=CCCCC2)cc1Cl |
| InChI | InChI=1S/C26H26ClF2N3O2S/c1-16-7-9-19(14-20(16)27)30-26-32(12-11-17-5-3-2-4-6-17)25(34)23(35-26)15-24(33)31-22-10-8-18(28)13-21(22)29/h5,7-10,13-14,23H,2-4,6,11-12,15H2,1H3,(H,31,33)/b30-26-/t23-/m1/s1 |
| InChIKey | RXKZHYZOBCTGDS-PCKLGSBKSA-N |
| XLogP | 6.78 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.03 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|