C22H19Cl2F2N3O2S — CID 4584577
2-[3-cyclopentyl-2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-difluorophenyl)acetamide (PubChem CID 4584577) has the molecular formula C22H19Cl2F2N3O2S and a molecular weight of 498.38 g/mol. Its IUPAC name is 2-[3-cyclopentyl-2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-difluorophenyl)acetamide.
| Compound Name | 2-[3-cyclopentyl-2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 4584577 |
| Molecular Formula | C22H19Cl2F2N3O2S |
| Molecular Weight | 498.38 g/mol |
| Exact Mass | 497.05 |
| IUPAC Name | 2-[3-cyclopentyl-2-(3,4-dichlorophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4-difluorophenyl)acetamide |
| SMILES | O=C(CC1S/C(=N\c2ccc(Cl)c(Cl)c2)N(C2CCCC2)C1=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C22H19Cl2F2N3O2S/c23-15-7-6-13(10-16(15)24)27-22-29(14-3-1-2-4-14)21(31)19(32-22)11-20(30)28-18-8-5-12(25)9-17(18)26/h5-10,14,19H,1-4,11H2,(H,28,30)/b27-22- |
| InChIKey | KWXLGJJBZTXZPB-QYQHSDTDSA-N |
| XLogP | 6.17 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.38 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|