C20H25Cl2N3O2S — CID 1217857
2-[(5S)-3-cycloheptyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 1217857) has the molecular formula C20H25Cl2N3O2S and a molecular weight of 442.41 g/mol. Its IUPAC name is 2-[(5S)-3-cycloheptyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[(5S)-3-cycloheptyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 1217857 |
| Molecular Formula | C20H25Cl2N3O2S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 2-[(5S)-3-cycloheptyl-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | CC/N=C1\S[C@@H](CC(=O)Nc2ccc(Cl)c(Cl)c2)C(=O)N1C1CCCCCC1 |
| InChI | InChI=1S/C20H25Cl2N3O2S/c1-2-23-20-25(14-7-5-3-4-6-8-14)19(27)17(28-20)12-18(26)24-13-9-10-15(21)16(22)11-13/h9-11,14,17H,2-8,12H2,1H3,(H,24,26)/b23-20-/t17-/m0/s1 |
| InChIKey | HSUVZLRXKILBAM-DVCONVQISA-N |
| XLogP | 5.36 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|