C20H27N3O2S — CID 1285662
2-[(5R)-3-cyclopentyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 1285662) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 2-[(5R)-3-cyclopentyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[(5R)-3-cyclopentyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 1285662 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[(5R)-3-cyclopentyl-2-methylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | C/N=C1\S[C@H](CC(=O)Nc2ccc(C(C)C)cc2)C(=O)N1C1CCCC1 |
| InChI | InChI=1S/C20H27N3O2S/c1-13(2)14-8-10-15(11-9-14)22-18(24)12-17-19(25)23(20(21-3)26-17)16-6-4-5-7-16/h8-11,13,16-17H,4-7,12H2,1-3H3,(H,22,24)/b21-20-/t17-/m1/s1 |
| InChIKey | AMHDRHWKOJDYJO-QBEKEKFNSA-N |
| XLogP | 4.01 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|