C24H26ClN3O4S2 — CID 51670297
N-(4-chlorophenyl)-2-[(5R)-3-cyclohexyl-2-(4-methylphenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 51670297) has the molecular formula C24H26ClN3O4S2 and a molecular weight of 520.08 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-[(5R)-3-cyclohexyl-2-(4-methylphenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(4-chlorophenyl)-2-[(5R)-3-cyclohexyl-2-(4-methylphenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 51670297 |
| Molecular Formula | C24H26ClN3O4S2 |
| Molecular Weight | 520.08 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | N-(4-chlorophenyl)-2-[(5R)-3-cyclohexyl-2-(4-methylphenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2S[C@H](CC(=O)Nc3ccc(Cl)cc3)C(=O)N2C2CCCCC2)cc1 |
| InChI | InChI=1S/C24H26ClN3O4S2/c1-16-7-13-20(14-8-16)34(31,32)27-24-28(19-5-3-2-4-6-19)23(30)21(33-24)15-22(29)26-18-11-9-17(25)10-12-18/h7-14,19,21H,2-6,15H2,1H3,(H,26,29)/t21-/m1/s1 |
| InChIKey | JQZDULICQUAWGA-OAQYLSRUSA-N |
| XLogP | 5.00 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.08 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|