C21H22ClN3O4S3 — CID 3921463
2-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-cyclohexyl-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 3921463) has the molecular formula C21H22ClN3O4S3 and a molecular weight of 512.08 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-cyclohexyl-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-cyclohexyl-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 3921463 |
| Molecular Formula | C21H22ClN3O4S3 |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)sulfonylimino-3-cyclohexyl-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(CC1SC(=NS(=O)(=O)c2ccc(Cl)s2)N(C2CCCCC2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H22ClN3O4S3/c22-17-11-12-19(31-17)32(28,29)24-21-25(15-9-5-2-6-10-15)20(27)16(30-21)13-18(26)23-14-7-3-1-4-8-14/h1,3-4,7-8,11-12,15-16H,2,5-6,9-10,13H2,(H,23,26) |
| InChIKey | WROLBUYWDYGOSB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|