C24H26FN3O5S2 — CID 51858939
2-[(5S)-3-cyclohexyl-2-(4-fluorophenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 51858939) has the molecular formula C24H26FN3O5S2 and a molecular weight of 519.62 g/mol. Its IUPAC name is 2-[(5S)-3-cyclohexyl-2-(4-fluorophenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5S)-3-cyclohexyl-2-(4-fluorophenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 51858939 |
| Molecular Formula | C24H26FN3O5S2 |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.13 |
| IUPAC Name | 2-[(5S)-3-cyclohexyl-2-(4-fluorophenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[C@@H]2SC(=NS(=O)(=O)c3ccc(F)cc3)N(C3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C24H26FN3O5S2/c1-33-19-11-9-17(10-12-19)26-22(29)15-21-23(30)28(18-5-3-2-4-6-18)24(34-21)27-35(31,32)20-13-7-16(25)8-14-20/h7-14,18,21H,2-6,15H2,1H3,(H,26,29)/t21-/m0/s1 |
| InChIKey | IXBANYWXHNPBSQ-NRFANRHFSA-N |
| XLogP | 4.18 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|