C19H17BrFN3O4S2 — CID 51567041
2-[(5R)-2-(4-bromophenyl)sulfonylimino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 51567041) has the molecular formula C19H17BrFN3O4S2 and a molecular weight of 514.40 g/mol. Its IUPAC name is 2-[(5R)-2-(4-bromophenyl)sulfonylimino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(5R)-2-(4-bromophenyl)sulfonylimino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 51567041 |
| Molecular Formula | C19H17BrFN3O4S2 |
| Molecular Weight | 514.40 g/mol |
| Exact Mass | 512.98 |
| IUPAC Name | 2-[(5R)-2-(4-bromophenyl)sulfonylimino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | CCN1C(=O)[C@@H](CC(=O)Nc2ccc(F)cc2)SC1=NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H17BrFN3O4S2/c1-2-24-18(26)16(11-17(25)22-14-7-5-13(21)6-8-14)29-19(24)23-30(27,28)15-9-3-12(20)4-10-15/h3-10,16H,2,11H2,1H3,(H,22,25)/t16-/m1/s1 |
| InChIKey | GNGLCIMACVIRII-MRXNPFEDSA-N |
| XLogP | 3.63 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|