C19H18FN3O4S2 — CID 6528950
2-[(2Z)-3-ethyl-2-(4-fluorophenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 6528950) has the molecular formula C19H18FN3O4S2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-[(2Z)-3-ethyl-2-(4-fluorophenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(2Z)-3-ethyl-2-(4-fluorophenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 6528950 |
| Molecular Formula | C19H18FN3O4S2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 2-[(2Z)-3-ethyl-2-(4-fluorophenyl)sulfonylimino-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccccc2)S/C1=N\S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H18FN3O4S2/c1-2-23-18(25)16(12-17(24)21-14-6-4-3-5-7-14)28-19(23)22-29(26,27)15-10-8-13(20)9-11-15/h3-11,16H,2,12H2,1H3,(H,21,24)/b22-19- |
| InChIKey | JDUXAOOJCKRNMI-QOCHGBHMSA-N |
| XLogP | 2.86 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|