C20H18ClN3O4S2 — CID 5234683
2-[2-(4-chlorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 5234683) has the molecular formula C20H18ClN3O4S2 and a molecular weight of 463.97 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[2-(4-chlorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 5234683 |
| Molecular Formula | C20H18ClN3O4S2 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | C=CCN1C(=O)C(CC(=O)Nc2ccccc2)SC1=NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O4S2/c1-2-12-24-19(26)17(13-18(25)22-15-6-4-3-5-7-15)29-20(24)23-30(27,28)16-10-8-14(21)9-11-16/h2-11,17H,1,12-13H2,(H,22,25) |
| InChIKey | LPYDWTNCTWOUMG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|