C21H20ClN3O4S2 — CID 27269034
2-[(5R)-2-(4-chlorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide (PubChem CID 27269034) has the molecular formula C21H20ClN3O4S2 and a molecular weight of 478.00 g/mol. Its IUPAC name is 2-[(5R)-2-(4-chlorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(5R)-2-(4-chlorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 27269034 |
| Molecular Formula | C21H20ClN3O4S2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.06 |
| IUPAC Name | 2-[(5R)-2-(4-chlorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide |
| SMILES | C=CCN1C(=O)[C@@H](CC(=O)Nc2ccccc2C)SC1=NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClN3O4S2/c1-3-12-25-20(27)18(13-19(26)23-17-7-5-4-6-14(17)2)30-21(25)24-31(28,29)16-10-8-15(22)9-11-16/h3-11,18H,1,12-13H2,2H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | PPMVFKABLCSUKC-GOSISDBHSA-N |
| XLogP | 3.85 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|