C20H20ClN3O4S2 — CID 4590729
2-[2-(4-chlorophenyl)sulfonylimino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide (PubChem CID 4590729) has the molecular formula C20H20ClN3O4S2 and a molecular weight of 465.98 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)sulfonylimino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-(4-chlorophenyl)sulfonylimino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 4590729 |
| Molecular Formula | C20H20ClN3O4S2 |
| Molecular Weight | 465.98 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | 2-[2-(4-chlorophenyl)sulfonylimino-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methylphenyl)acetamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2ccccc2C)SC1=NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20ClN3O4S2/c1-3-24-19(26)17(12-18(25)22-16-7-5-4-6-13(16)2)29-20(24)23-30(27,28)15-10-8-14(21)9-11-15/h4-11,17H,3,12H2,1-2H3,(H,22,25) |
| InChIKey | DBPKRXOGFKFFJU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.98 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|