C19H19N3O4S3 — CID 51445654
N-(2-methylphenyl)-2-[(5S)-4-oxo-3-prop-2-enyl-2-thiophen-2-ylsulfonylimino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 51445654) has the molecular formula C19H19N3O4S3 and a molecular weight of 449.58 g/mol. Its IUPAC name is N-(2-methylphenyl)-2-[(5S)-4-oxo-3-prop-2-enyl-2-thiophen-2-ylsulfonylimino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-methylphenyl)-2-[(5S)-4-oxo-3-prop-2-enyl-2-thiophen-2-ylsulfonylimino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 51445654 |
| Molecular Formula | C19H19N3O4S3 |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | N-(2-methylphenyl)-2-[(5S)-4-oxo-3-prop-2-enyl-2-thiophen-2-ylsulfonylimino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | C=CCN1C(=O)[C@H](CC(=O)Nc2ccccc2C)SC1=NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H19N3O4S3/c1-3-10-22-18(24)15(12-16(23)20-14-8-5-4-7-13(14)2)28-19(22)21-29(25,26)17-9-6-11-27-17/h3-9,11,15H,1,10,12H2,2H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | UIXUSXLXBLEGLM-HNNXBMFYSA-N |
| XLogP | 3.26 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|