C20H21N3O5S2 — CID 42223517
2-[(5S)-2-(benzenesulfonylimino)-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide (PubChem CID 42223517) has the molecular formula C20H21N3O5S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-[(5S)-2-(benzenesulfonylimino)-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[(5S)-2-(benzenesulfonylimino)-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 42223517 |
| Molecular Formula | C20H21N3O5S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 2-[(5S)-2-(benzenesulfonylimino)-3-ethyl-4-oxo-1,3-thiazolidin-5-yl]-N-(3-methoxyphenyl)acetamide |
| SMILES | CCN1C(=O)[C@H](CC(=O)Nc2cccc(OC)c2)SC1=NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H21N3O5S2/c1-3-23-19(25)17(13-18(24)21-14-8-7-9-15(12-14)28-2)29-20(23)22-30(26,27)16-10-5-4-6-11-16/h4-12,17H,3,13H2,1-2H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | CXESZFMYWRZCEV-KRWDZBQOSA-N |
| XLogP | 2.73 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|