C13H15FN2O3S2 — CID 2141666
N-[(5R)-3,5-diethyl-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide (PubChem CID 2141666) has the molecular formula C13H15FN2O3S2 and a molecular weight of 330.41 g/mol. Its IUPAC name is N-[(5R)-3,5-diethyl-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(5R)-3,5-diethyl-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 2141666 |
| Molecular Formula | C13H15FN2O3S2 |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[(5R)-3,5-diethyl-4-oxo-1,3-thiazolidin-2-ylidene]-4-fluorobenzenesulfonamide |
| SMILES | CC[C@H]1SC(=NS(=O)(=O)c2ccc(F)cc2)N(CC)C1=O |
| InChI | InChI=1S/C13H15FN2O3S2/c1-3-11-12(17)16(4-2)13(20-11)15-21(18,19)10-7-5-9(14)6-8-10/h5-8,11H,3-4H2,1-2H3/t11-/m1/s1 |
| InChIKey | PCMNADZKATXNNI-LLVKDONJSA-N |
| XLogP | 2.24 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|