C26H30FN3O5S2 — CID 3928746
2-[2-(4-fluorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(4-hexoxyphenyl)acetamide (PubChem CID 3928746) has the molecular formula C26H30FN3O5S2 and a molecular weight of 547.67 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(4-hexoxyphenyl)acetamide.
| Compound Name | 2-[2-(4-fluorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(4-hexoxyphenyl)acetamide |
|---|---|
| PubChem CID | 3928746 |
| Molecular Formula | C26H30FN3O5S2 |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.16 |
| IUPAC Name | 2-[2-(4-fluorophenyl)sulfonylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(4-hexoxyphenyl)acetamide |
| SMILES | C=CCN1C(=O)C(CC(=O)Nc2ccc(OCCCCCC)cc2)SC1=NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H30FN3O5S2/c1-3-5-6-7-17-35-21-12-10-20(11-13-21)28-24(31)18-23-25(32)30(16-4-2)26(36-23)29-37(33,34)22-14-8-19(27)9-15-22/h4,8-15,23H,2-3,5-7,16-18H2,1H3,(H,28,31) |
| InChIKey | NLWKNOHHIFCURP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|