C23H24FN3O3S — CID 41140769
2-[(5S)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(4-propoxyphenyl)acetamide (PubChem CID 41140769) has the molecular formula C23H24FN3O3S and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[(5S)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(4-propoxyphenyl)acetamide.
| Compound Name | 2-[(5S)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(4-propoxyphenyl)acetamide |
|---|---|
| PubChem CID | 41140769 |
| Molecular Formula | C23H24FN3O3S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 2-[(5S)-2-(4-fluorophenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-(4-propoxyphenyl)acetamide |
| SMILES | C=CCN1C(=O)[C@H](CC(=O)Nc2ccc(OCCC)cc2)S/C1=N\c1ccc(F)cc1 |
| InChI | InChI=1S/C23H24FN3O3S/c1-3-13-27-22(29)20(31-23(27)26-18-7-5-16(24)6-8-18)15-21(28)25-17-9-11-19(12-10-17)30-14-4-2/h3,5-12,20H,1,4,13-15H2,2H3,(H,25,28)/b26-23-/t20-/m0/s1 |
| InChIKey | BJXSASCEYKRPRS-UOODYVSWSA-N |
| XLogP | 4.76 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|