C24H25F2N3O3S — CID 3651525
N-(2,4-difluorophenyl)-2-[2-(2,4-dimethylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide (PubChem CID 3651525) has the molecular formula C24H25F2N3O3S and a molecular weight of 473.55 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-2-[2-(2,4-dimethylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,4-difluorophenyl)-2-[2-(2,4-dimethylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 3651525 |
| Molecular Formula | C24H25F2N3O3S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | N-(2,4-difluorophenyl)-2-[2-(2,4-dimethylphenyl)imino-4-oxo-3-(oxolan-2-ylmethyl)-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1ccc(/N=C2\SC(CC(=O)Nc3ccc(F)cc3F)C(=O)N2CC2CCCO2)c(C)c1 |
| InChI | InChI=1S/C24H25F2N3O3S/c1-14-5-7-19(15(2)10-14)28-24-29(13-17-4-3-9-32-17)23(31)21(33-24)12-22(30)27-20-8-6-16(25)11-18(20)26/h5-8,10-11,17,21H,3-4,9,12-13H2,1-2H3,(H,27,30)/b28-24- |
| InChIKey | GFVNNKVDKGHHJW-COOPMVRXSA-N |
| XLogP | 4.72 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|