C23H25N3O3S — CID 7796868
2-[(5R)-2-(2-methylphenyl)imino-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 7796868) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-[(5R)-2-(2-methylphenyl)imino-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(5R)-2-(2-methylphenyl)imino-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 7796868 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-[(5R)-2-(2-methylphenyl)imino-4-oxo-3-[[(2S)-oxolan-2-yl]methyl]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | Cc1ccccc1/N=C1\S[C@H](CC(=O)Nc2ccccc2)C(=O)N1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C23H25N3O3S/c1-16-8-5-6-12-19(16)25-23-26(15-18-11-7-13-29-18)22(28)20(30-23)14-21(27)24-17-9-3-2-4-10-17/h2-6,8-10,12,18,20H,7,11,13-15H2,1H3,(H,24,27)/b25-23-/t18-,20+/m0/s1 |
| InChIKey | UOPFEHQQRORZQA-VVWGVVMKSA-N |
| XLogP | 4.13 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|