C22H22ClN3O3S — CID 6597360
N-(3-chlorophenyl)-2-[(5S)-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]acetamide (PubChem CID 6597360) has the molecular formula C22H22ClN3O3S and a molecular weight of 443.96 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[(5S)-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[(5S)-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 6597360 |
| Molecular Formula | C22H22ClN3O3S |
| Molecular Weight | 443.96 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | N-(3-chlorophenyl)-2-[(5S)-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-phenylimino-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(C[C@@H]1S/C(=N\c2ccccc2)N(C[C@H]2CCCO2)C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22ClN3O3S/c23-15-6-4-9-17(12-15)24-20(27)13-19-21(28)26(14-18-10-5-11-29-18)22(30-19)25-16-7-2-1-3-8-16/h1-4,6-9,12,18-19H,5,10-11,13-14H2,(H,24,27)/b25-22-/t18-,19+/m1/s1 |
| InChIKey | OPNKBIMYEMHDBW-NWOXGCMFSA-N |
| XLogP | 4.48 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.96 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|