C28H32N4O5S — CID 98391680
2-[(5R)-3-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxy-4-nitrophenyl)acetamide (PubChem CID 98391680) has the molecular formula C28H32N4O5S and a molecular weight of 536.65 g/mol. Its IUPAC name is 2-[(5R)-3-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[(5R)-3-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 98391680 |
| Molecular Formula | C28H32N4O5S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | 2-[(5R)-3-[2-(cyclohexen-1-yl)ethyl]-2-(2,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxy-4-nitrophenyl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C[C@H]1S/C(=N\c2ccc(C)cc2C)N(CCC2=CCCCC2)C1=O |
| InChI | InChI=1S/C28H32N4O5S/c1-18-9-11-22(19(2)15-18)30-28-31(14-13-20-7-5-4-6-8-20)27(34)25(38-28)17-26(33)29-23-12-10-21(32(35)36)16-24(23)37-3/h7,9-12,15-16,25H,4-6,8,13-14,17H2,1-3H3,(H,29,33)/b30-28-/t25-/m1/s1 |
| InChIKey | GGBZVIYLJCNBIK-DXWCKFLSSA-N |
| XLogP | 6.07 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|