C22H24N4O4S — CID 21368577
2-[3-ethyl-2-(2-methyl-5-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-ethylphenyl)acetamide (PubChem CID 21368577) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is 2-[3-ethyl-2-(2-methyl-5-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-ethylphenyl)acetamide.
| Compound Name | 2-[3-ethyl-2-(2-methyl-5-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-ethylphenyl)acetamide |
|---|---|
| PubChem CID | 21368577 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[3-ethyl-2-(2-methyl-5-nitrophenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-ethylphenyl)acetamide |
| SMILES | CCc1ccc(NC(=O)CC2S/C(=N\c3cc([N+](=O)[O-])ccc3C)N(CC)C2=O)cc1 |
| InChI | InChI=1S/C22H24N4O4S/c1-4-15-7-9-16(10-8-15)23-20(27)13-19-21(28)25(5-2)22(31-19)24-18-12-17(26(29)30)11-6-14(18)3/h6-12,19H,4-5,13H2,1-3H3,(H,23,27)/b24-22- |
| InChIKey | QBISZHPVWQARTR-GYHWCHFESA-N |
| XLogP | 4.45 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|