C25H25N3O2S — CID 21368929
N-(3,5-dimethylphenyl)-2-(3-ethyl-2-naphthalen-1-ylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide (PubChem CID 21368929) has the molecular formula C25H25N3O2S and a molecular weight of 431.56 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-(3-ethyl-2-naphthalen-1-ylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-(3-ethyl-2-naphthalen-1-ylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 21368929 |
| Molecular Formula | C25H25N3O2S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-(3-ethyl-2-naphthalen-1-ylimino-4-oxo-1,3-thiazolidin-5-yl)acetamide |
| SMILES | CCN1C(=O)C(CC(=O)Nc2cc(C)cc(C)c2)S/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C25H25N3O2S/c1-4-28-24(30)22(15-23(29)26-19-13-16(2)12-17(3)14-19)31-25(28)27-21-11-7-9-18-8-5-6-10-20(18)21/h5-14,22H,4,15H2,1-3H3,(H,26,29)/b27-25- |
| InChIKey | LNIWJSBLJFYUBE-RFBIWTDZSA-N |
| XLogP | 5.44 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|