C25H23N3O3S — CID 5263516
N-(4-methoxyphenyl)-2-(2-naphthalen-1-ylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl)acetamide (PubChem CID 5263516) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-(2-naphthalen-1-ylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-(4-methoxyphenyl)-2-(2-naphthalen-1-ylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 5263516 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-(4-methoxyphenyl)-2-(2-naphthalen-1-ylimino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl)acetamide |
| SMILES | C=CCN1C(=O)C(CC(=O)Nc2ccc(OC)cc2)S/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C25H23N3O3S/c1-3-15-28-24(30)22(16-23(29)26-18-11-13-19(31-2)14-12-18)32-25(28)27-21-10-6-8-17-7-4-5-9-20(17)21/h3-14,22H,1,15-16H2,2H3,(H,26,29)/b27-25- |
| InChIKey | IRBKDFNUUKCZII-RFBIWTDZSA-N |
| XLogP | 4.99 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|