C21H18N3O4S- — CID 7025639
2-[[(5S)-5-(2-anilino-2-oxoethyl)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 7025639) has the molecular formula C21H18N3O4S- and a molecular weight of 408.46 g/mol. Its IUPAC name is 2-[[(5S)-5-(2-anilino-2-oxoethyl)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | 2-[[(5S)-5-(2-anilino-2-oxoethyl)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 7025639 |
| Molecular Formula | C21H18N3O4S- |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-[[(5S)-5-(2-anilino-2-oxoethyl)-4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | C=CCN1C(=O)[C@H](CC(=O)Nc2ccccc2)S/C1=N\c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C21H19N3O4S/c1-2-12-24-19(26)17(13-18(25)22-14-8-4-3-5-9-14)29-21(24)23-16-11-7-6-10-15(16)20(27)28/h2-11,17H,1,12-13H2,(H,22,25)(H,27,28)/p-1/b23-21-/t17-/m0/s1 |
| InChIKey | FNWLEHHQVABLON-JHGXHUTESA-M |
| XLogP | 2.20 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|