C24H26N4O5S2 — CID 26916396
2-[(5S)-2-(4-morpholin-4-ylsulfonylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 26916396) has the molecular formula C24H26N4O5S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is 2-[(5S)-2-(4-morpholin-4-ylsulfonylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(5S)-2-(4-morpholin-4-ylsulfonylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 26916396 |
| Molecular Formula | C24H26N4O5S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 2-[(5S)-2-(4-morpholin-4-ylsulfonylphenyl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | C=CCN1C(=O)[C@H](CC(=O)Nc2ccccc2)S/C1=N\c1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H26N4O5S2/c1-2-12-28-23(30)21(17-22(29)25-18-6-4-3-5-7-18)34-24(28)26-19-8-10-20(11-9-19)35(31,32)27-13-15-33-16-14-27/h2-11,21H,1,12-17H2,(H,25,29)/b26-24-/t21-/m0/s1 |
| InChIKey | LKVIZBBHSFXXAZ-TYGLDRHGSA-N |
| XLogP | 2.85 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|