C25H25N5O3S — CID 2937226
2-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 2937226) has the molecular formula C25H25N5O3S and a molecular weight of 475.57 g/mol. Its IUPAC name is 2-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 2937226 |
| Molecular Formula | C25H25N5O3S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-[2-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)imino-4-oxo-3-prop-2-enyl-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | C=CCN1C(=O)C(CC(=O)Nc2ccccc2)S/C1=N\c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C25H25N5O3S/c1-4-15-29-23(32)20(16-21(31)26-18-11-7-5-8-12-18)34-25(29)27-22-17(2)28(3)30(24(22)33)19-13-9-6-10-14-19/h4-14,20H,1,15-16H2,2-3H3,(H,26,31)/b27-25- |
| InChIKey | DYGYXSOVQRKBPI-RFBIWTDZSA-N |
| XLogP | 3.63 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|