C23H24ClFN4O3S — CID 25362043
2-[(5S)-2-(3-chloro-4-fluorophenyl)imino-3-(2-morpholin-4-ylethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 25362043) has the molecular formula C23H24ClFN4O3S and a molecular weight of 490.99 g/mol. Its IUPAC name is 2-[(5S)-2-(3-chloro-4-fluorophenyl)imino-3-(2-morpholin-4-ylethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[(5S)-2-(3-chloro-4-fluorophenyl)imino-3-(2-morpholin-4-ylethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 25362043 |
| Molecular Formula | C23H24ClFN4O3S |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 2-[(5S)-2-(3-chloro-4-fluorophenyl)imino-3-(2-morpholin-4-ylethyl)-4-oxo-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(C[C@@H]1S/C(=N\c2ccc(F)c(Cl)c2)N(CCN2CCOCC2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H24ClFN4O3S/c24-18-14-17(6-7-19(18)25)27-23-29(9-8-28-10-12-32-13-11-28)22(31)20(33-23)15-21(30)26-16-4-2-1-3-5-16/h1-7,14,20H,8-13,15H2,(H,26,30)/b27-23-/t20-/m0/s1 |
| InChIKey | CKXYNXWBJXSRRE-XSMOSBQLSA-N |
| XLogP | 3.77 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|