C24H22N4O6S — CID 46802613
2-[3-(furan-2-ylmethyl)-2-(3-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxy-5-nitrophenyl)acetamide (PubChem CID 46802613) has the molecular formula C24H22N4O6S and a molecular weight of 494.53 g/mol. Its IUPAC name is 2-[3-(furan-2-ylmethyl)-2-(3-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxy-5-nitrophenyl)acetamide.
| Compound Name | 2-[3-(furan-2-ylmethyl)-2-(3-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 46802613 |
| Molecular Formula | C24H22N4O6S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 2-[3-(furan-2-ylmethyl)-2-(3-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-methoxy-5-nitrophenyl)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CC1S/C(=N\c2cccc(C)c2)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C24H22N4O6S/c1-15-5-3-6-16(11-15)25-24-27(14-18-7-4-10-34-18)23(30)21(35-24)13-22(29)26-19-12-17(28(31)32)8-9-20(19)33-2/h3-12,21H,13-14H2,1-2H3,(H,26,29)/b25-24- |
| InChIKey | ALOXYGBODFDXQY-IZHYLOQSSA-N |
| XLogP | 4.67 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|