C27H28N4O5S — CID 4544716
N-(2-methoxy-4-nitrophenyl)-2-(2-naphthalen-1-ylimino-4-oxo-3-pentan-2-yl-1,3-thiazolidin-5-yl)acetamide (PubChem CID 4544716) has the molecular formula C27H28N4O5S and a molecular weight of 520.61 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-2-(2-naphthalen-1-ylimino-4-oxo-3-pentan-2-yl-1,3-thiazolidin-5-yl)acetamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-2-(2-naphthalen-1-ylimino-4-oxo-3-pentan-2-yl-1,3-thiazolidin-5-yl)acetamide |
|---|---|
| PubChem CID | 4544716 |
| Molecular Formula | C27H28N4O5S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-2-(2-naphthalen-1-ylimino-4-oxo-3-pentan-2-yl-1,3-thiazolidin-5-yl)acetamide |
| SMILES | CCCC(C)N1C(=O)C(CC(=O)Nc2ccc([N+](=O)[O-])cc2OC)S/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C27H28N4O5S/c1-4-8-17(2)30-26(33)24(16-25(32)28-22-14-13-19(31(34)35)15-23(22)36-3)37-27(30)29-21-12-7-10-18-9-5-6-11-20(18)21/h5-7,9-15,17,24H,4,8,16H2,1-3H3,(H,28,32)/b29-27- |
| InChIKey | JJSUHPPGKBTBOO-OHYPFYFLSA-N |
| XLogP | 5.91 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|