C19H18N4O6S — CID 135953982
N-(2-methoxy-4-nitrophenyl)-2-[(5R)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135953982) has the molecular formula C19H18N4O6S and a molecular weight of 430.44 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-2-[(5R)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-2-[(5R)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135953982 |
| Molecular Formula | C19H18N4O6S |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-2-[(5R)-2-(4-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | COc1ccc(/N=C2\NC(=O)[C@@H](CC(=O)Nc3ccc([N+](=O)[O-])cc3OC)S2)cc1 |
| InChI | InChI=1S/C19H18N4O6S/c1-28-13-6-3-11(4-7-13)20-19-22-18(25)16(30-19)10-17(24)21-14-8-5-12(23(26)27)9-15(14)29-2/h3-9,16H,10H2,1-2H3,(H,21,24)(H,20,22,25)/t16-/m1/s1 |
| InChIKey | DNEFEWZIZNSPAY-MRXNPFEDSA-N |
| XLogP | 2.86 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|