C19H16N3O5S- — CID 135816491
4-[[(5S)-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 135816491) has the molecular formula C19H16N3O5S- and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[[(5S)-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | 4-[[(5S)-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 135816491 |
| Molecular Formula | C19H16N3O5S- |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 4-[[(5S)-5-[2-(4-methoxyanilino)-2-oxoethyl]-4-oxo-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COc1ccc(NC(=O)C[C@@H]2S/C(=N/c3ccc(C(=O)[O-])cc3)NC2=O)cc1 |
| InChI | InChI=1S/C19H17N3O5S/c1-27-14-8-6-12(7-9-14)20-16(23)10-15-17(24)22-19(28-15)21-13-4-2-11(3-5-13)18(25)26/h2-9,15H,10H2,1H3,(H,20,23)(H,25,26)(H,21,22,24)/p-1/t15-/m0/s1 |
| InChIKey | AXVFYGUWRDKMSD-HNNXBMFYSA-M |
| XLogP | 1.31 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|