C20H21N3O3S — CID 135691647
2-[(5S)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 135691647) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 2-[(5S)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5S)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135691647 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 2-[(5S)-2-(2,5-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C[C@@H]2S/C(=N\c3cc(C)ccc3C)NC2=O)cc1 |
| InChI | InChI=1S/C20H21N3O3S/c1-12-4-5-13(2)16(10-12)22-20-23-19(25)17(27-20)11-18(24)21-14-6-8-15(26-3)9-7-14/h4-10,17H,11H2,1-3H3,(H,21,24)(H,22,23,25)/t17-/m0/s1 |
| InChIKey | HNQNYMWVTPTDFV-KRWDZBQOSA-N |
| XLogP | 3.56 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|