C22H25N3O3S — CID 135725303
2-[(5S)-2-(2,6-diethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 135725303) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-[(5S)-2-(2,6-diethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5S)-2-(2,6-diethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 135725303 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-[(5S)-2-(2,6-diethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1/N=C1/NC(=O)[C@H](CC(=O)Nc2ccc(OC)cc2)S1 |
| InChI | InChI=1S/C22H25N3O3S/c1-4-14-7-6-8-15(5-2)20(14)24-22-25-21(27)18(29-22)13-19(26)23-16-9-11-17(28-3)12-10-16/h6-12,18H,4-5,13H2,1-3H3,(H,23,26)(H,24,25,27)/t18-/m0/s1 |
| InChIKey | JCFZQILUNQUDCM-SFHVURJKSA-N |
| XLogP | 4.07 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|